C16H21N3O2S — CID 170379496
(3R,4R,6S)-4-N-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-ethyloxane-3,4-diamine (PubChem CID 170379496) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is (3R,4R,6S)-4-N-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-ethyloxane-3,4-diamine.
| Compound Name | (3R,4R,6S)-4-N-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-ethyloxane-3,4-diamine |
|---|---|
| PubChem CID | 170379496 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (3R,4R,6S)-4-N-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-ethyloxane-3,4-diamine |
| SMILES | CC[C@H]1C[C@@H](Nc2nc3c4c(ccc3s2)OCC4)[C@@H](N)CO1 |
| InChI | InChI=1S/C16H21N3O2S/c1-2-9-7-12(11(17)8-21-9)18-16-19-15-10-5-6-20-13(10)3-4-14(15)22-16/h3-4,9,11-12H,2,5-8,17H2,1H3,(H,18,19)/t9-,11-,12+/m0/s1 |
| InChIKey | ONWHJBAHKXOYNZ-ZMLRMANQSA-N |
| XLogP | 2.54 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |