C30H35N3O2SSi — CID 177070925
(1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-N-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)cyclopentane-1,2-diamine (PubChem CID 177070925) has the molecular formula C30H35N3O2SSi and a molecular weight of 529.78 g/mol. Its IUPAC name is (1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-N-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)cyclopentane-1,2-diamine.
| Compound Name | (1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-N-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)cyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 177070925 |
| Molecular Formula | C30H35N3O2SSi |
| Molecular Weight | 529.78 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | (1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-N-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)cyclopentane-1,2-diamine |
| SMILES | CC(C)(C)[Si](O[C@@H]1C[C@H](N)[C@H](Nc2nc3c4c(ccc3s2)OCC4)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H35N3O2SSi/c1-30(2,3)37(21-10-6-4-7-11-21,22-12-8-5-9-13-22)35-20-18-24(31)25(19-20)32-29-33-28-23-16-17-34-26(23)14-15-27(28)36-29/h4-15,20,24-25H,16-19,31H2,1-3H3,(H,32,33)/t20-,24+,25-/m1/s1 |
| InChIKey | KJPXBIVLKJGBBP-DCEDVJGZSA-N |
| XLogP | 5.08 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.78 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|