C16H19N3O3S — CID 177070924
[(1R,2R,3R)-2-amino-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)cyclopentyl] acetate (PubChem CID 177070924) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is [(1R,2R,3R)-2-amino-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)cyclopentyl] acetate.
| Compound Name | [(1R,2R,3R)-2-amino-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)cyclopentyl] acetate |
|---|---|
| PubChem CID | 177070924 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [(1R,2R,3R)-2-amino-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)cyclopentyl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@H](Nc2nc3c4c(ccc3s2)OCC4)[C@H]1N |
| InChI | InChI=1S/C16H19N3O3S/c1-8(20)22-12-3-2-10(14(12)17)18-16-19-15-9-6-7-21-11(9)4-5-13(15)23-16/h4-5,10,12,14H,2-3,6-7,17H2,1H3,(H,18,19)/t10-,12-,14-/m1/s1 |
| InChIKey | FSIXATOYDDWGIH-MPKXVKKWSA-N |
| XLogP | 2.06 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |