C12H14N2O — CID 175890130
8-methoxy-3-prop-2-ynyl-2,4-dihydro-1H-quinazoline (PubChem CID 175890130) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 8-methoxy-3-prop-2-ynyl-2,4-dihydro-1H-quinazoline.
| Compound Name | 8-methoxy-3-prop-2-ynyl-2,4-dihydro-1H-quinazoline |
|---|---|
| PubChem CID | 175890130 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 8-methoxy-3-prop-2-ynyl-2,4-dihydro-1H-quinazoline |
| SMILES | C#CCN1CNc2c(cccc2OC)C1 |
| InChI | InChI=1S/C12H14N2O/c1-3-7-14-8-10-5-4-6-11(15-2)12(10)13-9-14/h1,4-6,13H,7-9H2,2H3 |
| InChIKey | VEFBETJKJJMFLB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|