C23H31FN4O4S — CID 175890687
tert-butyl 2-[2-[(2-benzylsulfonylhydrazinyl)methyl]phenyl]-4-fluoropiperazine-1-carboxylate (PubChem CID 175890687) has the molecular formula C23H31FN4O4S and a molecular weight of 478.59 g/mol. Its IUPAC name is tert-butyl 2-[2-[(2-benzylsulfonylhydrazinyl)methyl]phenyl]-4-fluoropiperazine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(2-benzylsulfonylhydrazinyl)methyl]phenyl]-4-fluoropiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175890687 |
| Molecular Formula | C23H31FN4O4S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | tert-butyl 2-[2-[(2-benzylsulfonylhydrazinyl)methyl]phenyl]-4-fluoropiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(F)CC1c1ccccc1CNNS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H31FN4O4S/c1-23(2,3)32-22(29)28-14-13-27(24)16-21(28)20-12-8-7-11-19(20)15-25-26-33(30,31)17-18-9-5-4-6-10-18/h4-12,21,25-26H,13-17H2,1-3H3 |
| InChIKey | NXCUYOIWBLSBMR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|