C23H30F2N4O4S — CID 175891058
tert-butyl 3,5-difluoro-2-[2-[[2-(4-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate (PubChem CID 175891058) has the molecular formula C23H30F2N4O4S and a molecular weight of 496.58 g/mol. Its IUPAC name is tert-butyl 3,5-difluoro-2-[2-[[2-(4-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3,5-difluoro-2-[2-[[2-(4-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175891058 |
| Molecular Formula | C23H30F2N4O4S |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | tert-butyl 3,5-difluoro-2-[2-[[2-(4-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)NNCc2ccccc2C2C(F)NC(F)CN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H30F2N4O4S/c1-15-9-11-17(12-10-15)34(31,32)28-26-13-16-7-5-6-8-18(16)20-21(25)27-19(24)14-29(20)22(30)33-23(2,3)4/h5-12,19-21,26-28H,13-14H2,1-4H3 |
| InChIKey | PNAMGBWWQHLPDO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|