C23H31BrN4O4S — CID 175386857
tert-butyl 4-[5-bromo-2-[[2-(4-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate (PubChem CID 175386857) has the molecular formula C23H31BrN4O4S and a molecular weight of 539.50 g/mol. Its IUPAC name is tert-butyl 4-[5-bromo-2-[[2-(4-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-bromo-2-[[2-(4-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175386857 |
| Molecular Formula | C23H31BrN4O4S |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | tert-butyl 4-[5-bromo-2-[[2-(4-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)NNCc2ccc(Br)cc2N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H31BrN4O4S/c1-17-5-9-20(10-6-17)33(30,31)26-25-16-18-7-8-19(24)15-21(18)27-11-13-28(14-12-27)22(29)32-23(2,3)4/h5-10,15,25-26H,11-14,16H2,1-4H3 |
| InChIKey | NCGQGMGHISOSLV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|