C23H30F2N4O4S — CID 162434228
tert-butyl 4,5-difluoro-2-[2-[[2-(2-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate (PubChem CID 162434228) has the molecular formula C23H30F2N4O4S and a molecular weight of 496.58 g/mol. Its IUPAC name is tert-butyl 4,5-difluoro-2-[2-[[2-(2-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4,5-difluoro-2-[2-[[2-(2-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 162434228 |
| Molecular Formula | C23H30F2N4O4S |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | tert-butyl 4,5-difluoro-2-[2-[[2-(2-methylphenyl)sulfonylhydrazinyl]methyl]phenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccccc1S(=O)(=O)NNCc1ccccc1C1CN(F)C(F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H30F2N4O4S/c1-16-9-5-8-12-20(16)34(31,32)27-26-13-17-10-6-7-11-18(17)19-14-29(25)21(24)15-28(19)22(30)33-23(2,3)4/h5-12,19,21,26-27H,13-15H2,1-4H3 |
| InChIKey | KOJJNZQGJGWVHJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|