C23H30ClFN4O4S — CID 175890962
tert-butyl 2-[2-[(2-benzylsulfonylhydrazinyl)methyl]phenyl]-5-chloro-3-fluoropiperazine-1-carboxylate (PubChem CID 175890962) has the molecular formula C23H30ClFN4O4S and a molecular weight of 513.04 g/mol. Its IUPAC name is tert-butyl 2-[2-[(2-benzylsulfonylhydrazinyl)methyl]phenyl]-5-chloro-3-fluoropiperazine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(2-benzylsulfonylhydrazinyl)methyl]phenyl]-5-chloro-3-fluoropiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175890962 |
| Molecular Formula | C23H30ClFN4O4S |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | tert-butyl 2-[2-[(2-benzylsulfonylhydrazinyl)methyl]phenyl]-5-chloro-3-fluoropiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Cl)NC(F)C1c1ccccc1CNNS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H30ClFN4O4S/c1-23(2,3)33-22(30)29-14-19(24)27-21(25)20(29)18-12-8-7-11-17(18)13-26-28-34(31,32)15-16-9-5-4-6-10-16/h4-12,19-21,26-28H,13-15H2,1-3H3 |
| InChIKey | NYLFNDJIXFEKQF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|