C15H11F2NO — CID 175894161
1,3-difluoro-2-(4-methoxyphenyl)indole (PubChem CID 175894161) has the molecular formula C15H11F2NO and a molecular weight of 259.26 g/mol. Its IUPAC name is 1,3-difluoro-2-(4-methoxyphenyl)indole.
| Compound Name | 1,3-difluoro-2-(4-methoxyphenyl)indole |
|---|---|
| PubChem CID | 175894161 |
| Molecular Formula | C15H11F2NO |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1,3-difluoro-2-(4-methoxyphenyl)indole |
| SMILES | COc1ccc(-c2c(F)c3ccccc3n2F)cc1 |
| InChI | InChI=1S/C15H11F2NO/c1-19-11-8-6-10(7-9-11)15-14(16)12-4-2-3-5-13(12)18(15)17/h2-9H,1H3 |
| InChIKey | SHFSINPLDZKOKG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |