C18H27F3N2O3 — CID 175899412
N-[(2S,3R)-1-[(1S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-(1-methylcyclobutyl)oxy-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 175899412) has the molecular formula C18H27F3N2O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is N-[(2S,3R)-1-[(1S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-(1-methylcyclobutyl)oxy-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3R)-1-[(1S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-(1-methylcyclobutyl)oxy-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 175899412 |
| Molecular Formula | C18H27F3N2O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-[(2S,3R)-1-[(1S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-(1-methylcyclobutyl)oxy-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H](OC1(C)CCC1)[C@H](NC(=O)C(F)(F)F)C(=O)N1C[C@@H]2[C@H](C1)C2(C)C |
| InChI | InChI=1S/C18H27F3N2O3/c1-10(26-17(4)6-5-7-17)13(22-15(25)18(19,20)21)14(24)23-8-11-12(9-23)16(11,2)3/h10-13H,5-9H2,1-4H3,(H,22,25)/t10-,11-,12+,13+/m1/s1 |
| InChIKey | FYNBRZPSKUACSB-NDBYEHHHSA-N |
| XLogP | 2.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |