C12H19N3O3S2 — CID 1759
4-sulfamoyl-N-[4-(sulfanylmethylamino)butyl]benzamide (PubChem CID 1759) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 4-sulfamoyl-N-[4-(sulfanylmethylamino)butyl]benzamide.
| Compound Name | 4-sulfamoyl-N-[4-(sulfanylmethylamino)butyl]benzamide |
|---|---|
| PubChem CID | 1759 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-sulfamoyl-N-[4-(sulfanylmethylamino)butyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCCCCNCS)cc1 |
| InChI | InChI=1S/C12H19N3O3S2/c13-20(17,18)11-5-3-10(4-6-11)12(16)15-8-2-1-7-14-9-19/h3-6,14,19H,1-2,7-9H2,(H,15,16)(H2,13,17,18) |
| InChIKey | XLYYIFIRODREFK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|