C8H8F2N2O2 — CID 175900992
N-(3,3-difluorocyclobutyl)-1,2-oxazole-3-carboxamide (PubChem CID 175900992) has the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. Its IUPAC name is N-(3,3-difluorocyclobutyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(3,3-difluorocyclobutyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 175900992 |
| Molecular Formula | C8H8F2N2O2 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | N-(3,3-difluorocyclobutyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CC(F)(F)C1)c1ccon1 |
| InChI | InChI=1S/C8H8F2N2O2/c9-8(10)3-5(4-8)11-7(13)6-1-2-14-12-6/h1-2,5H,3-4H2,(H,11,13) |
| InChIKey | RTCZWIHAISIXCN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |