About diethyltin(2+) sulfite
diethyltin(2+) sulfite (PubChem CID 175907900) has the molecular formula C4H10O3SSn
and a molecular weight of 256.90 g/mol. Its IUPAC name is diethyltin(2+) sulfite.
Molecular Properties
| Compound Name | diethyltin(2+) sulfite |
| PubChem CID | 175907900 |
| Molecular Formula | C4H10O3SSn |
| Molecular Weight | 256.90 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | diethyltin(2+) sulfite |
| SMILES | CC[Sn+2]CC.O=S([O-])[O-] |
| InChI | InChI=1S/2C2H5.H2O3S.Sn/c2*1-2;1-4(2)3;/h2*1H2,2H3;(H2,1,2,3);/q;;;+2/p-2 |
| InChIKey | CJAVDJJQFOUFQJ-UHFFFAOYSA-L |
| XLogP | 0.56 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.90 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze diethyltin(2+) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyltin(2+) sulfite?
The IUPAC name of diethyltin(2+) sulfite (CID 175907900) is diethyltin(2+) sulfite.
What is the SMILES notation for diethyltin(2+) sulfite?
The canonical SMILES for diethyltin(2+) sulfite is CC[Sn+2]CC.O=S([O-])[O-].
What is the InChIKey of diethyltin(2+) sulfite?
The InChIKey is CJAVDJJQFOUFQJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H5.H2O3S.Sn/c2*1-2;1-4(2)3;/h2*1H2,2H3;(H2,1,2,3);/q;;;+2/p-2.
What are the key properties of diethyltin(2+) sulfite?
diethyltin(2+) sulfite has a molecular weight of 256.90 g/mol, XLogP of 0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethyltin(2+) sulfite is sourced from PubChem (CID 175907900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).