About carbanide;methanesulfinate;tungsten(2+)
carbanide;methanesulfinate;tungsten(2+) (PubChem CID 22951813) has the molecular formula C2H6O2SW
and a molecular weight of 277.98 g/mol. Its IUPAC name is carbanide;methanesulfinate;tungsten(2+).
Molecular Properties
| Compound Name | carbanide;methanesulfinate;tungsten(2+) |
| PubChem CID | 22951813 |
| Molecular Formula | C2H6O2SW |
| Molecular Weight | 277.98 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | carbanide;methanesulfinate;tungsten(2+) |
| SMILES | CS(=O)[O-].[CH3-].[W+2] |
| InChI | InChI=1S/CH4O2S.CH3.W/c1-4(2)3;;/h1H3,(H,2,3);1H3;/q;-1;+2/p-1 |
| InChIKey | ILTFFEDNFRKLIR-UHFFFAOYSA-M |
| XLogP | -0.06 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.98 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze carbanide;methanesulfinate;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;methanesulfinate;tungsten(2+)?
The IUPAC name of carbanide;methanesulfinate;tungsten(2+) (CID 22951813) is carbanide;methanesulfinate;tungsten(2+).
What is the SMILES notation for carbanide;methanesulfinate;tungsten(2+)?
The canonical SMILES for carbanide;methanesulfinate;tungsten(2+) is CS(=O)[O-].[CH3-].[W+2].
What is the InChIKey of carbanide;methanesulfinate;tungsten(2+)?
The InChIKey is ILTFFEDNFRKLIR-UHFFFAOYSA-M. The full InChI is InChI=1S/CH4O2S.CH3.W/c1-4(2)3;;/h1H3,(H,2,3);1H3;/q;-1;+2/p-1.
What are the key properties of carbanide;methanesulfinate;tungsten(2+)?
carbanide;methanesulfinate;tungsten(2+) has a molecular weight of 277.98 g/mol, XLogP of -0.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;methanesulfinate;tungsten(2+) is sourced from PubChem (CID 22951813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).