About magnesium;methanesulfinate;bromide
magnesium;methanesulfinate;bromide (PubChem CID 172757399) has the molecular formula CH3BrMgO2S
and a molecular weight of 183.31 g/mol. Its IUPAC name is magnesium;methanesulfinate;bromide.
Molecular Properties
| Compound Name | magnesium;methanesulfinate;bromide |
| PubChem CID | 172757399 |
| Molecular Formula | CH3BrMgO2S |
| Molecular Weight | 183.31 g/mol |
| Exact Mass | 181.89 |
| IUPAC Name | magnesium;methanesulfinate;bromide |
| SMILES | CS(=O)[O-].[Br-].[Mg+2] |
| InChI | InChI=1S/CH4O2S.BrH.Mg/c1-4(2)3;;/h1H3,(H,2,3);1H;/q;;+2/p-2 |
| InChIKey | WQHKXPFHSJOWTP-UHFFFAOYSA-L |
| XLogP | -3.88 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.31 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze magnesium;methanesulfinate;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;methanesulfinate;bromide?
The IUPAC name of magnesium;methanesulfinate;bromide (CID 172757399) is magnesium;methanesulfinate;bromide.
What is the SMILES notation for magnesium;methanesulfinate;bromide?
The canonical SMILES for magnesium;methanesulfinate;bromide is CS(=O)[O-].[Br-].[Mg+2].
What is the InChIKey of magnesium;methanesulfinate;bromide?
The InChIKey is WQHKXPFHSJOWTP-UHFFFAOYSA-L. The full InChI is InChI=1S/CH4O2S.BrH.Mg/c1-4(2)3;;/h1H3,(H,2,3);1H;/q;;+2/p-2.
What are the key properties of magnesium;methanesulfinate;bromide?
magnesium;methanesulfinate;bromide has a molecular weight of 183.31 g/mol, XLogP of -3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;methanesulfinate;bromide is sourced from PubChem (CID 172757399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).