About magnesium methyl sulfite
magnesium methyl sulfite (PubChem CID 88792923) has the molecular formula C2H6MgO6S2
and a molecular weight of 214.50 g/mol. Its IUPAC name is magnesium methyl sulfite.
Molecular Properties
| Compound Name | magnesium methyl sulfite |
| PubChem CID | 88792923 |
| Molecular Formula | C2H6MgO6S2 |
| Molecular Weight | 214.50 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | magnesium methyl sulfite |
| SMILES | COS(=O)[O-].COS(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2CH4O3S.Mg/c2*1-4-5(2)3;/h2*1H3,(H,2,3);/q;;+2/p-2 |
| InChIKey | HIMWZEDDACSAKH-UHFFFAOYSA-L |
| XLogP | -1.53 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.50 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze magnesium methyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium methyl sulfite?
The IUPAC name of magnesium methyl sulfite (CID 88792923) is magnesium methyl sulfite.
What is the SMILES notation for magnesium methyl sulfite?
The canonical SMILES for magnesium methyl sulfite is COS(=O)[O-].COS(=O)[O-].[Mg+2].
What is the InChIKey of magnesium methyl sulfite?
The InChIKey is HIMWZEDDACSAKH-UHFFFAOYSA-L. The full InChI is InChI=1S/2CH4O3S.Mg/c2*1-4-5(2)3;/h2*1H3,(H,2,3);/q;;+2/p-2.
What are the key properties of magnesium methyl sulfite?
magnesium methyl sulfite has a molecular weight of 214.50 g/mol, XLogP of -1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium methyl sulfite is sourced from PubChem (CID 88792923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).