About zinc methyl sulfite
zinc methyl sulfite (PubChem CID 88792512) has the molecular formula C2H6O6S2Zn
and a molecular weight of 255.59 g/mol. Its IUPAC name is zinc methyl sulfite.
Molecular Properties
| Compound Name | zinc methyl sulfite |
| PubChem CID | 88792512 |
| Molecular Formula | C2H6O6S2Zn |
| Molecular Weight | 255.59 g/mol |
| Exact Mass | 253.89 |
| IUPAC Name | zinc methyl sulfite |
| SMILES | COS(=O)[O-].COS(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2CH4O3S.Zn/c2*1-4-5(2)3;/h2*1H3,(H,2,3);/q;;+2/p-2 |
| InChIKey | CXFMADOSIZGZDS-UHFFFAOYSA-L |
| XLogP | -1.15 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.59 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze zinc methyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc methyl sulfite?
The IUPAC name of zinc methyl sulfite (CID 88792512) is zinc methyl sulfite.
What is the SMILES notation for zinc methyl sulfite?
The canonical SMILES for zinc methyl sulfite is COS(=O)[O-].COS(=O)[O-].[Zn+2].
What is the InChIKey of zinc methyl sulfite?
The InChIKey is CXFMADOSIZGZDS-UHFFFAOYSA-L. The full InChI is InChI=1S/2CH4O3S.Zn/c2*1-4-5(2)3;/h2*1H3,(H,2,3);/q;;+2/p-2.
What are the key properties of zinc methyl sulfite?
zinc methyl sulfite has a molecular weight of 255.59 g/mol, XLogP of -1.15, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc methyl sulfite is sourced from PubChem (CID 88792512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).