About 1H-imidazol-3-ium;methyl sulfite
1H-imidazol-3-ium;methyl sulfite (PubChem CID 69341581) has the molecular formula C4H8N2O3S
and a molecular weight of 164.19 g/mol. Its IUPAC name is 1H-imidazol-3-ium;methyl sulfite.
Molecular Properties
| Compound Name | 1H-imidazol-3-ium;methyl sulfite |
| PubChem CID | 69341581 |
| Molecular Formula | C4H8N2O3S |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 1H-imidazol-3-ium;methyl sulfite |
| SMILES | COS(=O)[O-].c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C3H4N2.CH4O3S/c1-2-5-3-4-1;1-4-5(2)3/h1-3H,(H,4,5);1H3,(H,2,3) |
| InChIKey | LMFVUDJHKNOYKJ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazol-3-ium;methyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-3-ium;methyl sulfite?
The IUPAC name of 1H-imidazol-3-ium;methyl sulfite (CID 69341581) is 1H-imidazol-3-ium;methyl sulfite.
What is the SMILES notation for 1H-imidazol-3-ium;methyl sulfite?
The canonical SMILES for 1H-imidazol-3-ium;methyl sulfite is COS(=O)[O-].c1c[nH+]c[nH]1.
What is the InChIKey of 1H-imidazol-3-ium;methyl sulfite?
The InChIKey is LMFVUDJHKNOYKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.CH4O3S/c1-2-5-3-4-1;1-4-5(2)3/h1-3H,(H,4,5);1H3,(H,2,3).
What are the key properties of 1H-imidazol-3-ium;methyl sulfite?
1H-imidazol-3-ium;methyl sulfite has a molecular weight of 164.19 g/mol, XLogP of -0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-3-ium;methyl sulfite is sourced from PubChem (CID 69341581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).