About strontium methanesulfinate
strontium methanesulfinate (PubChem CID 140863677) has the molecular formula C2H6O4S2Sr
and a molecular weight of 245.82 g/mol. Its IUPAC name is strontium methanesulfinate.
Molecular Properties
| Compound Name | strontium methanesulfinate |
| PubChem CID | 140863677 |
| Molecular Formula | C2H6O4S2Sr |
| Molecular Weight | 245.82 g/mol |
| Exact Mass | 245.88 |
| IUPAC Name | strontium methanesulfinate |
| SMILES | CS(=O)[O-].CS(=O)[O-].[Sr+2] |
| InChI | InChI=1S/2CH4O2S.Sr/c2*1-4(2)3;/h2*1H3,(H,2,3);/q;;+2/p-2 |
| InChIKey | HUSRWHDXQKDRPF-UHFFFAOYSA-L |
| XLogP | -1.39 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.82 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze strontium methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium methanesulfinate?
The IUPAC name of strontium methanesulfinate (CID 140863677) is strontium methanesulfinate.
What is the SMILES notation for strontium methanesulfinate?
The canonical SMILES for strontium methanesulfinate is CS(=O)[O-].CS(=O)[O-].[Sr+2].
What is the InChIKey of strontium methanesulfinate?
The InChIKey is HUSRWHDXQKDRPF-UHFFFAOYSA-L. The full InChI is InChI=1S/2CH4O2S.Sr/c2*1-4(2)3;/h2*1H3,(H,2,3);/q;;+2/p-2.
What are the key properties of strontium methanesulfinate?
strontium methanesulfinate has a molecular weight of 245.82 g/mol, XLogP of -1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for strontium methanesulfinate is sourced from PubChem (CID 140863677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).