C25H37F2NO4 — CID 175912395
6-[2-[6-(4,4-difluoro-4-phenylbutoxy)hexylamino]-1-hydroxyethyl]-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 175912395) has the molecular formula C25H37F2NO4 and a molecular weight of 453.57 g/mol. Its IUPAC name is 6-[2-[6-(4,4-difluoro-4-phenylbutoxy)hexylamino]-1-hydroxyethyl]-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 6-[2-[6-(4,4-difluoro-4-phenylbutoxy)hexylamino]-1-hydroxyethyl]-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 175912395 |
| Molecular Formula | C25H37F2NO4 |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 6-[2-[6-(4,4-difluoro-4-phenylbutoxy)hexylamino]-1-hydroxyethyl]-6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | OCC1(C(O)CNCCCCCCOCCCC(F)(F)c2ccccc2)C=CC=CC1O |
| InChI | InChI=1S/C25H37F2NO4/c26-25(27,21-11-4-3-5-12-21)15-10-18-32-17-9-2-1-8-16-28-19-23(31)24(20-29)14-7-6-13-22(24)30/h3-7,11-14,22-23,28-31H,1-2,8-10,15-20H2 |
| InChIKey | YXPPEERSLZJQLP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|