C16H25FN4O — CID 175912498
(2R)-1-[2-fluoro-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-4-pyridinyl]-2-methylpiperazine (PubChem CID 175912498) has the molecular formula C16H25FN4O and a molecular weight of 308.40 g/mol. Its IUPAC name is (2R)-1-[2-fluoro-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-4-pyridinyl]-2-methylpiperazine.
| Compound Name | (2R)-1-[2-fluoro-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-4-pyridinyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 175912498 |
| Molecular Formula | C16H25FN4O |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (2R)-1-[2-fluoro-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-4-pyridinyl]-2-methylpiperazine |
| SMILES | C[C@@H]1CNCCN1c1cc(F)nc(OC[C@@H]2CCCN2C)c1 |
| InChI | InChI=1S/C16H25FN4O/c1-12-10-18-5-7-21(12)14-8-15(17)19-16(9-14)22-11-13-4-3-6-20(13)2/h8-9,12-13,18H,3-7,10-11H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | ZQOOAWRQESUNOE-OLZOCXBDSA-N |
| XLogP | 1.49 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|