C13H17F3N4O2 — CID 175914079
[6-(1-methylpiperidin-4-yl)oxy-5-(trifluoromethyl)-3-pyridinyl]urea (PubChem CID 175914079) has the molecular formula C13H17F3N4O2 and a molecular weight of 318.30 g/mol. Its IUPAC name is [6-(1-methylpiperidin-4-yl)oxy-5-(trifluoromethyl)-3-pyridinyl]urea.
| Compound Name | [6-(1-methylpiperidin-4-yl)oxy-5-(trifluoromethyl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 175914079 |
| Molecular Formula | C13H17F3N4O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [6-(1-methylpiperidin-4-yl)oxy-5-(trifluoromethyl)-3-pyridinyl]urea |
| SMILES | CN1CCC(Oc2ncc(NC(N)=O)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H17F3N4O2/c1-20-4-2-9(3-5-20)22-11-10(13(14,15)16)6-8(7-18-11)19-12(17)21/h6-7,9H,2-5H2,1H3,(H3,17,19,21) |
| InChIKey | VLFJXEFQKRUVAL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |