C45H53N7O3 — CID 175914647
3-[5-[4-[[1-[[1-(3-aminopropyl)-3-(3-hydroxynaphthalen-1-yl)indol-5-yl]methyl]piperidin-4-yl]methyl]piperazin-1-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 175914647) has the molecular formula C45H53N7O3 and a molecular weight of 739.97 g/mol. Its IUPAC name is 3-[5-[4-[[1-[[1-(3-aminopropyl)-3-(3-hydroxynaphthalen-1-yl)indol-5-yl]methyl]piperidin-4-yl]methyl]piperazin-1-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[4-[[1-[[1-(3-aminopropyl)-3-(3-hydroxynaphthalen-1-yl)indol-5-yl]methyl]piperidin-4-yl]methyl]piperazin-1-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175914647 |
| Molecular Formula | C45H53N7O3 |
| Molecular Weight | 739.97 g/mol |
| Exact Mass | 739.42 |
| IUPAC Name | 3-[5-[4-[[1-[[1-(3-aminopropyl)-3-(3-hydroxynaphthalen-1-yl)indol-5-yl]methyl]piperidin-4-yl]methyl]piperazin-1-yl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | NCCCn1cc(-c2cc(O)cc3ccccc23)c2cc(CN3CCC(CN4CCN(c5ccc6c(c5)CN(C5CCC(=O)NC5=O)C6)CC4)CC3)ccc21 |
| InChI | InChI=1S/C45H53N7O3/c46-14-3-15-51-30-41(39-25-37(53)24-33-4-1-2-5-38(33)39)40-22-32(6-9-42(40)51)27-48-16-12-31(13-17-48)26-49-18-20-50(21-19-49)36-8-7-34-28-52(29-35(34)23-36)43-10-11-44(54)47-45(43)55/h1-2,4-9,22-25,30-31,43,53H,3,10-21,26-29,46H2,(H,47,54,55) |
| InChIKey | RNSFPYTZOHIFPN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.97 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|