C21H16F3N3O5S — CID 175920477
[4-[7-(2,5-dihydropyridin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-2-yl]-3-methoxyphenyl] trifluoromethanesulfonate (PubChem CID 175920477) has the molecular formula C21H16F3N3O5S and a molecular weight of 479.44 g/mol. Its IUPAC name is [4-[7-(2,5-dihydropyridin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-2-yl]-3-methoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[7-(2,5-dihydropyridin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-2-yl]-3-methoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175920477 |
| Molecular Formula | C21H16F3N3O5S |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | [4-[7-(2,5-dihydropyridin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-2-yl]-3-methoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)ccc1-c1cc(=O)n2cc(C3=CCN=CC3)ccc2n1 |
| InChI | InChI=1S/C21H16F3N3O5S/c1-31-18-10-15(32-33(29,30)21(22,23)24)3-4-16(18)17-11-20(28)27-12-14(2-5-19(27)26-17)13-6-8-25-9-7-13/h2-6,9-12H,7-8H2,1H3 |
| InChIKey | PEUZTWSKCNUVAB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 99.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|