C27H29N5O — CID 175924786
1-[3-[(9-ethylcarbazol-3-yl)methylamino]butyl]benzimidazole-5-carboxamide (PubChem CID 175924786) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is 1-[3-[(9-ethylcarbazol-3-yl)methylamino]butyl]benzimidazole-5-carboxamide.
| Compound Name | 1-[3-[(9-ethylcarbazol-3-yl)methylamino]butyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 175924786 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 1-[3-[(9-ethylcarbazol-3-yl)methylamino]butyl]benzimidazole-5-carboxamide |
| SMILES | CCn1c2ccccc2c2cc(CNC(C)CCn3cnc4cc(C(N)=O)ccc43)ccc21 |
| InChI | InChI=1S/C27H29N5O/c1-3-32-24-7-5-4-6-21(24)22-14-19(8-10-25(22)32)16-29-18(2)12-13-31-17-30-23-15-20(27(28)33)9-11-26(23)31/h4-11,14-15,17-18,29H,3,12-13,16H2,1-2H3,(H2,28,33) |
| InChIKey | ZZYBHWUAIRIDBT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |