C33H37Br2NO2S4 — CID 175927568
1-(4-bromo-1,3-thiazol-2-yl)-3-(3-bromothiophen-2-yl)-5,7-bis(2-ethylhexyl)thieno[3,4-f][2]benzothiole-4,8-dione (PubChem CID 175927568) has the molecular formula C33H37Br2NO2S4 and a molecular weight of 767.74 g/mol. Its IUPAC name is 1-(4-bromo-1,3-thiazol-2-yl)-3-(3-bromothiophen-2-yl)-5,7-bis(2-ethylhexyl)thieno[3,4-f][2]benzothiole-4,8-dione.
| Compound Name | 1-(4-bromo-1,3-thiazol-2-yl)-3-(3-bromothiophen-2-yl)-5,7-bis(2-ethylhexyl)thieno[3,4-f][2]benzothiole-4,8-dione |
|---|---|
| PubChem CID | 175927568 |
| Molecular Formula | C33H37Br2NO2S4 |
| Molecular Weight | 767.74 g/mol |
| Exact Mass | 765.01 |
| IUPAC Name | 1-(4-bromo-1,3-thiazol-2-yl)-3-(3-bromothiophen-2-yl)-5,7-bis(2-ethylhexyl)thieno[3,4-f][2]benzothiole-4,8-dione |
| SMILES | CCCCC(CC)Cc1sc(CC(CC)CCCC)c2c1C(=O)c1c(-c3nc(Br)cs3)sc(-c3sccc3Br)c1C2=O |
| InChI | InChI=1S/C33H37Br2NO2S4/c1-5-9-11-18(7-3)15-21-24-25(22(41-21)16-19(8-4)12-10-6-2)29(38)27-26(28(24)37)31(30-20(34)13-14-39-30)42-32(27)33-36-23(35)17-40-33/h13-14,17-19H,5-12,15-16H2,1-4H3 |
| InChIKey | JAPGMKZRCCYMHR-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.74 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|