C27H48N2O5Si — CID 175927737
tert-butyl N-[(E)-6-[(2S,3R)-2-(2-methylprop-1-enyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]-6-oxohex-4-enyl]carbamate (PubChem CID 175927737) has the molecular formula C27H48N2O5Si and a molecular weight of 508.78 g/mol. Its IUPAC name is tert-butyl N-[(E)-6-[(2S,3R)-2-(2-methylprop-1-enyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]-6-oxohex-4-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-6-[(2S,3R)-2-(2-methylprop-1-enyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]-6-oxohex-4-enyl]carbamate |
|---|---|
| PubChem CID | 175927737 |
| Molecular Formula | C27H48N2O5Si |
| Molecular Weight | 508.78 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | tert-butyl N-[(E)-6-[(2S,3R)-2-(2-methylprop-1-enyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]-6-oxohex-4-enyl]carbamate |
| SMILES | CC(C)=C[C@H]1[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C(=O)N1C(=O)/C=C/CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H48N2O5Si/c1-18(2)17-22-24(34-35(19(3)4,20(5)6)21(7)8)25(31)29(22)23(30)15-13-12-14-16-28-26(32)33-27(9,10)11/h13,15,17,19-22,24H,12,14,16H2,1-11H3,(H,28,32)/b15-13+/t22-,24+/m0/s1 |
| InChIKey | ZYZATUZQNFZJJV-SPHGZTGMSA-N |
| XLogP | 6.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.78 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|