About 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol
4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol (PubChem CID 175935281) has the molecular formula C18H21BrN4O
and a molecular weight of 389.30 g/mol. Its IUPAC name is 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol |
| PubChem CID | 175935281 |
| Molecular Formula | C18H21BrN4O |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol |
| SMILES | NC1=NCCc2c1c(-c1ccc(Br)cc1)nn2C1CCC(O)CC1 |
| InChI | InChI=1S/C18H21BrN4O/c19-12-3-1-11(2-4-12)17-16-15(9-10-21-18(16)20)23(22-17)13-5-7-14(24)8-6-13/h1-4,13-14,24H,5-10H2,(H2,20,21) |
| InChIKey | YDACWTPUVIUMTJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol?
The IUPAC name of 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol (CID 175935281) is 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol.
What is the SMILES notation for 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol?
The canonical SMILES for 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol is NC1=NCCc2c1c(-c1ccc(Br)cc1)nn2C1CCC(O)CC1.
What is the InChIKey of 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol?
The InChIKey is YDACWTPUVIUMTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21BrN4O/c19-12-3-1-11(2-4-12)17-16-15(9-10-21-18(16)20)23(22-17)13-5-7-14(24)8-6-13/h1-4,13-14,24H,5-10H2,(H2,20,21).
What are the key properties of 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol?
4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol has a molecular weight of 389.30 g/mol, XLogP of 3.05, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-amino-3-(4-bromophenyl)-6,7-dihydropyrazolo[4,3-c]pyridin-1-yl]cyclohexan-1-ol is sourced from PubChem (CID 175935281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).