C18H18BrN3O3 — CID 176774284
ethyl 3-(4-bromophenyl)-1-(3-hydroxycyclopentyl)-4-isocyanopyrazole-5-carboxylate (PubChem CID 176774284) has the molecular formula C18H18BrN3O3 and a molecular weight of 404.26 g/mol. Its IUPAC name is ethyl 3-(4-bromophenyl)-1-(3-hydroxycyclopentyl)-4-isocyanopyrazole-5-carboxylate.
| Compound Name | ethyl 3-(4-bromophenyl)-1-(3-hydroxycyclopentyl)-4-isocyanopyrazole-5-carboxylate |
|---|---|
| PubChem CID | 176774284 |
| Molecular Formula | C18H18BrN3O3 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | ethyl 3-(4-bromophenyl)-1-(3-hydroxycyclopentyl)-4-isocyanopyrazole-5-carboxylate |
| SMILES | [C-]#[N+]c1c(-c2ccc(Br)cc2)nn(C2CCC(O)C2)c1C(=O)OCC |
| InChI | InChI=1S/C18H18BrN3O3/c1-3-25-18(24)17-16(20-2)15(11-4-6-12(19)7-5-11)21-22(17)13-8-9-14(23)10-13/h4-7,13-14,23H,3,8-10H2,1H3 |
| InChIKey | GDIUXBDKLPYCAV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|