C10H13NO2 — CID 175938033
1-(3,6-dihydro-2H-pyridin-1-yl)pent-2-ene-1,4-dione (PubChem CID 175938033) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyridin-1-yl)pent-2-ene-1,4-dione.
| Compound Name | 1-(3,6-dihydro-2H-pyridin-1-yl)pent-2-ene-1,4-dione |
|---|---|
| PubChem CID | 175938033 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyridin-1-yl)pent-2-ene-1,4-dione |
| SMILES | CC(=O)C=CC(=O)N1CC=CCC1 |
| InChI | InChI=1S/C10H13NO2/c1-9(12)5-6-10(13)11-7-3-2-4-8-11/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | XJFOLNKNPHJYBG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|