C7H8FNO — CID 146498996
(E)-1-(2,5-dihydropyrrol-1-yl)-3-fluoroprop-2-en-1-one (PubChem CID 146498996) has the molecular formula C7H8FNO and a molecular weight of 141.14 g/mol. Its IUPAC name is (E)-1-(2,5-dihydropyrrol-1-yl)-3-fluoroprop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dihydropyrrol-1-yl)-3-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 146498996 |
| Molecular Formula | C7H8FNO |
| Molecular Weight | 141.14 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | (E)-1-(2,5-dihydropyrrol-1-yl)-3-fluoroprop-2-en-1-one |
| SMILES | O=C(/C=C/F)N1CC=CC1 |
| InChI | InChI=1S/C7H8FNO/c8-4-3-7(10)9-5-1-2-6-9/h1-4H,5-6H2/b4-3+ |
| InChIKey | JXWXJIMKBKGBRL-ONEGZZNKSA-N |
| XLogP | 0.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.14 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|