C35H44F3N5O2 — CID 175944171
3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-(2,5-dihydropyridin-3-yl)-1-(2,2,2-trifluoroethyl)indol-3-yl]-2,2-dimethylpropan-1-ol (PubChem CID 175944171) has the molecular formula C35H44F3N5O2 and a molecular weight of 623.76 g/mol. Its IUPAC name is 3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-(2,5-dihydropyridin-3-yl)-1-(2,2,2-trifluoroethyl)indol-3-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-(2,5-dihydropyridin-3-yl)-1-(2,2,2-trifluoroethyl)indol-3-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 175944171 |
| Molecular Formula | C35H44F3N5O2 |
| Molecular Weight | 623.76 g/mol |
| Exact Mass | 623.34 |
| IUPAC Name | 3-[2-[5-(4-cyclopropylpiperazin-1-yl)-2-[(1S)-1-methoxyethyl]-3-pyridinyl]-5-(2,5-dihydropyridin-3-yl)-1-(2,2,2-trifluoroethyl)indol-3-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CO[C@@H](C)c1ncc(N2CCN(C3CC3)CC2)cc1-c1c(CC(C)(C)CO)c2cc(C3=CCC=NC3)ccc2n1CC(F)(F)F |
| InChI | InChI=1S/C35H44F3N5O2/c1-23(45-4)32-29(17-27(20-40-32)42-14-12-41(13-15-42)26-8-9-26)33-30(18-34(2,3)22-44)28-16-24(25-6-5-11-39-19-25)7-10-31(28)43(33)21-35(36,37)38/h6-7,10-11,16-17,20,23,26,44H,5,8-9,12-15,18-19,21-22H2,1-4H3/t23-/m0/s1 |
| InChIKey | XVJOFRKYSUJASP-QHCPKHFHSA-N |
| XLogP | 6.68 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.76 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |