C24H26Cl2N6O3 — CID 175945624
1-[1-[6-amino-5-(2,3-dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-yl]-3-N-hydroxycyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 175945624) has the molecular formula C24H26Cl2N6O3 and a molecular weight of 517.42 g/mol. Its IUPAC name is 1-[1-[6-amino-5-(2,3-dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-yl]-3-N-hydroxycyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[1-[6-amino-5-(2,3-dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-yl]-3-N-hydroxycyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 175945624 |
| Molecular Formula | C24H26Cl2N6O3 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 1-[1-[6-amino-5-(2,3-dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-yl]-3-N-hydroxycyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CC1(C2(C(N)=O)C=CC=C(C(=O)NO)C2)CCN(c2cnc(-c3cccc(Cl)c3Cl)c(N)n2)CC1 |
| InChI | InChI=1S/C24H26Cl2N6O3/c1-23(24(22(28)34)7-3-4-14(12-24)21(33)31-35)8-10-32(11-9-23)17-13-29-19(20(27)30-17)15-5-2-6-16(25)18(15)26/h2-7,13,35H,8-12H2,1H3,(H2,27,30)(H2,28,34)(H,31,33) |
| InChIKey | DLXWDFGDTCFGSP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|