C19H20F3N2O2S- — CID 175949329
2-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-3-[(sulfinatoamino)methyl]piperidine (PubChem CID 175949329) has the molecular formula C19H20F3N2O2S- and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-3-[(sulfinatoamino)methyl]piperidine.
| Compound Name | 2-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-3-[(sulfinatoamino)methyl]piperidine |
|---|---|
| PubChem CID | 175949329 |
| Molecular Formula | C19H20F3N2O2S- |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-3-[(sulfinatoamino)methyl]piperidine |
| SMILES | O=S([O-])NCC1CCCNC1Cc1cccc(-c2cc(F)cc(F)c2)c1F |
| InChI | InChI=1S/C19H21F3N2O2S/c20-15-7-14(8-16(21)10-15)17-5-1-3-12(19(17)22)9-18-13(4-2-6-23-18)11-24-27(25)26/h1,3,5,7-8,10,13,18,23-24H,2,4,6,9,11H2,(H,25,26)/p-1 |
| InChIKey | FDOKWHPYCHLJDV-UHFFFAOYSA-M |
| XLogP | 3.07 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|