C20H19ClF2N4O — CID 175950949
6-chloro-4-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-1-methyl-1,5-naphthyridin-2-one (PubChem CID 175950949) has the molecular formula C20H19ClF2N4O and a molecular weight of 404.85 g/mol. Its IUPAC name is 6-chloro-4-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-1-methyl-1,5-naphthyridin-2-one.
| Compound Name | 6-chloro-4-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-1-methyl-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 175950949 |
| Molecular Formula | C20H19ClF2N4O |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 6-chloro-4-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-1-methyl-1,5-naphthyridin-2-one |
| SMILES | Cn1c(=O)cc(N2CCN(Cc3ccc(F)cc3F)CC2)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C20H19ClF2N4O/c1-25-16-4-5-18(21)24-20(16)17(11-19(25)28)27-8-6-26(7-9-27)12-13-2-3-14(22)10-15(13)23/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | JQERFVFUMYBARR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|