C32H33N7O4 — CID 175951032
4-[6-(3,5-dimethyl-4-quinazolin-2-ylpyrazol-1-yl)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 175951032) has the molecular formula C32H33N7O4 and a molecular weight of 579.66 g/mol. Its IUPAC name is 4-[6-(3,5-dimethyl-4-quinazolin-2-ylpyrazol-1-yl)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[6-(3,5-dimethyl-4-quinazolin-2-ylpyrazol-1-yl)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175951032 |
| Molecular Formula | C32H33N7O4 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 4-[6-(3,5-dimethyl-4-quinazolin-2-ylpyrazol-1-yl)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Cc1nn(CCCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)c(C)c1-c1ncc2ccccc2n1 |
| InChI | InChI=1S/C32H33N7O4/c1-19-27(29-34-18-21-10-5-6-12-23(21)35-29)20(2)38(37-19)17-8-4-3-7-16-33-24-13-9-11-22-28(24)32(43)39(31(22)42)25-14-15-26(40)36-30(25)41/h5-6,9-13,18,25,33H,3-4,7-8,14-17H2,1-2H3,(H,36,40,41) |
| InChIKey | BDZYACWCJGBVQY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|