C33H32F3N7O4 — CID 166994306
5-[6-[3,5-dimethyl-4-[3-(trifluoromethyl)quinoxalin-2-yl]pyrazol-1-yl]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 166994306) has the molecular formula C33H32F3N7O4 and a molecular weight of 647.66 g/mol. Its IUPAC name is 5-[6-[3,5-dimethyl-4-[3-(trifluoromethyl)quinoxalin-2-yl]pyrazol-1-yl]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[6-[3,5-dimethyl-4-[3-(trifluoromethyl)quinoxalin-2-yl]pyrazol-1-yl]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166994306 |
| Molecular Formula | C33H32F3N7O4 |
| Molecular Weight | 647.66 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | 5-[6-[3,5-dimethyl-4-[3-(trifluoromethyl)quinoxalin-2-yl]pyrazol-1-yl]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Cc1nn(CCCCCCNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)c(C)c1-c1nc2ccccc2nc1C(F)(F)F |
| InChI | InChI=1S/C33H32F3N7O4/c1-18-27(28-29(33(34,35)36)39-24-10-6-5-9-23(24)38-28)19(2)42(41-18)16-8-4-3-7-15-37-20-11-12-21-22(17-20)32(47)43(31(21)46)25-13-14-26(44)40-30(25)45/h5-6,9-12,17,25,37H,3-4,7-8,13-16H2,1-2H3,(H,40,44,45) |
| InChIKey | ZUYOTHVGMJWSBT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|