C16H13Cl2F4N3O4S — CID 175958012
2-chloro-N-(4-chloro-2-fluorophenyl)-5-[(2S)-2-(trifluoromethylsulfonylamino)propoxy]pyridine-3-carboxamide (PubChem CID 175958012) has the molecular formula C16H13Cl2F4N3O4S and a molecular weight of 490.26 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-2-fluorophenyl)-5-[(2S)-2-(trifluoromethylsulfonylamino)propoxy]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(4-chloro-2-fluorophenyl)-5-[(2S)-2-(trifluoromethylsulfonylamino)propoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175958012 |
| Molecular Formula | C16H13Cl2F4N3O4S |
| Molecular Weight | 490.26 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | 2-chloro-N-(4-chloro-2-fluorophenyl)-5-[(2S)-2-(trifluoromethylsulfonylamino)propoxy]pyridine-3-carboxamide |
| SMILES | C[C@@H](COc1cnc(Cl)c(C(=O)Nc2ccc(Cl)cc2F)c1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H13Cl2F4N3O4S/c1-8(25-30(27,28)16(20,21)22)7-29-10-5-11(14(18)23-6-10)15(26)24-13-3-2-9(17)4-12(13)19/h2-6,8,25H,7H2,1H3,(H,24,26)/t8-/m0/s1 |
| InChIKey | MGWUJWOAQKZPMO-QMMMGPOBSA-N |
| XLogP | 3.99 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|