C10H13NO — CID 175958584
(8R)-4-methyl-5,6,7,8-tetrahydroquinolin-8-ol (PubChem CID 175958584) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (8R)-4-methyl-5,6,7,8-tetrahydroquinolin-8-ol.
| Compound Name | (8R)-4-methyl-5,6,7,8-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 175958584 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (8R)-4-methyl-5,6,7,8-tetrahydroquinolin-8-ol |
| SMILES | Cc1ccnc2c1CCC[C@H]2O |
| InChI | InChI=1S/C10H13NO/c1-7-5-6-11-10-8(7)3-2-4-9(10)12/h5-6,9,12H,2-4H2,1H3/t9-/m1/s1 |
| InChIKey | AZQAAMVKTXBMOL-SECBINFHSA-N |
| XLogP | 1.76 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |