C10H14N2O — CID 97184033
(8S)-4-methoxy-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 97184033) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is (8S)-4-methoxy-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-4-methoxy-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 97184033 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (8S)-4-methoxy-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | COc1ccnc2c1CCC[C@@H]2N |
| InChI | InChI=1S/C10H14N2O/c1-13-9-5-6-12-10-7(9)3-2-4-8(10)11/h5-6,8H,2-4,11H2,1H3/t8-/m0/s1 |
| InChIKey | RAAFWHDPWRQKAW-QMMMGPOBSA-N |
| XLogP | 1.43 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |