C8H10N2O — CID 156850758
3-methyl-6,7-dihydro-5H-cyclopenta[b]pyrazin-7-ol (PubChem CID 156850758) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-methyl-6,7-dihydro-5H-cyclopenta[b]pyrazin-7-ol.
| Compound Name | 3-methyl-6,7-dihydro-5H-cyclopenta[b]pyrazin-7-ol |
|---|---|
| PubChem CID | 156850758 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3-methyl-6,7-dihydro-5H-cyclopenta[b]pyrazin-7-ol |
| SMILES | Cc1cnc2c(n1)CCC2O |
| InChI | InChI=1S/C8H10N2O/c1-5-4-9-8-6(10-5)2-3-7(8)11/h4,7,11H,2-3H2,1H3 |
| InChIKey | QZFNNWVBCNPWFB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |