C19H22N2O2 — CID 175963063
1,4-dibenzyl-2,3,3,5,5,6,6-heptadeuteriopiperazine-2-carboxylic acid (PubChem CID 175963063) has the molecular formula C19H22N2O2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 1,4-dibenzyl-2,3,3,5,5,6,6-heptadeuteriopiperazine-2-carboxylic acid.
| Compound Name | 1,4-dibenzyl-2,3,3,5,5,6,6-heptadeuteriopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 175963063 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1,4-dibenzyl-2,3,3,5,5,6,6-heptadeuteriopiperazine-2-carboxylic acid |
| SMILES | [2H]C1([2H])N(Cc2ccccc2)C([2H])([2H])C([2H])(C(=O)O)N(Cc2ccccc2)C1([2H])[2H] |
| InChI | InChI=1S/C19H22N2O2/c22-19(23)18-15-20(13-16-7-3-1-4-8-16)11-12-21(18)14-17-9-5-2-6-10-17/h1-10,18H,11-15H2,(H,22,23)/i11D2,12D2,15D2,18D |
| InChIKey | OMZRNAXQJKWLAQ-VYOLXSGQSA-N |
| XLogP | 2.46 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |