About 3-benzylimidazolidine-1,5-dicarboxylic acid
3-benzylimidazolidine-1,5-dicarboxylic acid (PubChem CID 123700435) has the molecular formula C12H14N2O4
and a molecular weight of 250.25 g/mol. Its IUPAC name is 3-benzylimidazolidine-1,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-benzylimidazolidine-1,5-dicarboxylic acid |
| PubChem CID | 123700435 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-benzylimidazolidine-1,5-dicarboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccccc2)CN1C(=O)O |
| InChI | InChI=1S/C12H14N2O4/c15-11(16)10-7-13(8-14(10)12(17)18)6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,15,16)(H,17,18) |
| InChIKey | FYZOOEWNEKWXMR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzylimidazolidine-1,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylimidazolidine-1,5-dicarboxylic acid?
The IUPAC name of 3-benzylimidazolidine-1,5-dicarboxylic acid (CID 123700435) is 3-benzylimidazolidine-1,5-dicarboxylic acid.
What is the SMILES notation for 3-benzylimidazolidine-1,5-dicarboxylic acid?
The canonical SMILES for 3-benzylimidazolidine-1,5-dicarboxylic acid is O=C(O)C1CN(Cc2ccccc2)CN1C(=O)O.
What is the InChIKey of 3-benzylimidazolidine-1,5-dicarboxylic acid?
The InChIKey is FYZOOEWNEKWXMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4/c15-11(16)10-7-13(8-14(10)12(17)18)6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,15,16)(H,17,18).
What are the key properties of 3-benzylimidazolidine-1,5-dicarboxylic acid?
3-benzylimidazolidine-1,5-dicarboxylic acid has a molecular weight of 250.25 g/mol, XLogP of 0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylimidazolidine-1,5-dicarboxylic acid is sourced from PubChem (CID 123700435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).