C3H11BrO7P2 — CID 175963384
1-bromopropane;phosphono dihydrogen phosphate (PubChem CID 175963384) has the molecular formula C3H11BrO7P2 and a molecular weight of 300.97 g/mol. Its IUPAC name is 1-bromopropane;phosphono dihydrogen phosphate.
| Compound Name | 1-bromopropane;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 175963384 |
| Molecular Formula | C3H11BrO7P2 |
| Molecular Weight | 300.97 g/mol |
| Exact Mass | 299.92 |
| IUPAC Name | 1-bromopropane;phosphono dihydrogen phosphate |
| SMILES | CCCBr.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C3H7Br.H4O7P2/c1-2-3-4;1-8(2,3)7-9(4,5)6/h2-3H2,1H3;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | WTYJTXSCZVNWDH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.97 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|