C13H13N3 — CID 175963628
1,2-dimethyl-3-(1H-pyrrol-2-yl)pyrrolo[3,2-c]pyridine (PubChem CID 175963628) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 1,2-dimethyl-3-(1H-pyrrol-2-yl)pyrrolo[3,2-c]pyridine.
| Compound Name | 1,2-dimethyl-3-(1H-pyrrol-2-yl)pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 175963628 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1,2-dimethyl-3-(1H-pyrrol-2-yl)pyrrolo[3,2-c]pyridine |
| SMILES | Cc1c(-c2ccc[nH]2)c2cnccc2n1C |
| InChI | InChI=1S/C13H13N3/c1-9-13(11-4-3-6-15-11)10-8-14-7-5-12(10)16(9)2/h3-8,15H,1-2H3 |
| InChIKey | VEHPOMFPQCHQIJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |