C14H21O5P — CID 175964652
(4-cyclopentyl-3,5-dimethoxyphenyl)methylphosphonic acid (PubChem CID 175964652) has the molecular formula C14H21O5P and a molecular weight of 300.29 g/mol. Its IUPAC name is (4-cyclopentyl-3,5-dimethoxyphenyl)methylphosphonic acid.
| Compound Name | (4-cyclopentyl-3,5-dimethoxyphenyl)methylphosphonic acid |
|---|---|
| PubChem CID | 175964652 |
| Molecular Formula | C14H21O5P |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (4-cyclopentyl-3,5-dimethoxyphenyl)methylphosphonic acid |
| SMILES | COc1cc(CP(=O)(O)O)cc(OC)c1C1CCCC1 |
| InChI | InChI=1S/C14H21O5P/c1-18-12-7-10(9-20(15,16)17)8-13(19-2)14(12)11-5-3-4-6-11/h7-8,11H,3-6,9H2,1-2H3,(H2,15,16,17) |
| InChIKey | GSUXXRFYRMHITE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|