About CID 175968575
CID 175968575 (PubChem CID 175968575) has the molecular formula C6H18B4O8
and a molecular weight of 261.45 g/mol.
Molecular Properties
| Compound Name | CID 175968575 |
| PubChem CID | 175968575 |
| Molecular Formula | C6H18B4O8 |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O.O[B]O[B]O.O[B]O[B]O |
| InChI | InChI=1S/C6H14O2.2B2H2O3/c1-5(2,7)6(3,4)8;2*3-1-5-2-4/h7-8H,1-4H3;2*3-4H |
| InChIKey | GJEJAWGNCWEPPA-UHFFFAOYSA-N |
| XLogP | -3.36 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175968575 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175968575?
The IUPAC name of CID 175968575 (CID 175968575) is not available.
What is the SMILES notation for CID 175968575?
The canonical SMILES for CID 175968575 is CC(C)(O)C(C)(C)O.O[B]O[B]O.O[B]O[B]O.
What is the InChIKey of CID 175968575?
The InChIKey is GJEJAWGNCWEPPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.2B2H2O3/c1-5(2,7)6(3,4)8;2*3-1-5-2-4/h7-8H,1-4H3;2*3-4H.
What are the key properties of CID 175968575?
CID 175968575 has a molecular weight of 261.45 g/mol, XLogP of -3.36, 5 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175968575 is sourced from PubChem (CID 175968575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).