C30H24F5N3O6 — CID 175970626
4-[[(4S)-3-[6-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-2-pyridinyl]-1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-4-yl]oxy]benzoic acid (PubChem CID 175970626) has the molecular formula C30H24F5N3O6 and a molecular weight of 617.53 g/mol. Its IUPAC name is 4-[[(4S)-3-[6-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-2-pyridinyl]-1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-4-yl]oxy]benzoic acid.
| Compound Name | 4-[[(4S)-3-[6-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-2-pyridinyl]-1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-4-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 175970626 |
| Molecular Formula | C30H24F5N3O6 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | 4-[[(4S)-3-[6-[(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethoxy]-2-pyridinyl]-1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-4-yl]oxy]benzoic acid |
| SMILES | C[C@H](Oc1cccc(-c2nn(CC(F)(F)F)c3c2[C@@H](Oc2ccc(C(=O)O)cc2)CCC3)n1)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C30H24F5N3O6/c1-16(18-10-13-22-24(14-18)44-30(34,35)43-22)41-25-7-2-4-20(36-25)27-26-21(38(37-27)15-29(31,32)33)5-3-6-23(26)42-19-11-8-17(9-12-19)28(39)40/h2,4,7-14,16,23H,3,5-6,15H2,1H3,(H,39,40)/t16-,23-/m0/s1 |
| InChIKey | RXSGHGAESKUGMG-HJPURHCSSA-N |
| XLogP | 7.12 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |