C29H38N4O3 — CID 175971441
3-[6-[2-(2-tert-butyl-1-piperidin-4-ylpiperidin-4-yl)ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 175971441) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is 3-[6-[2-(2-tert-butyl-1-piperidin-4-ylpiperidin-4-yl)ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-(2-tert-butyl-1-piperidin-4-ylpiperidin-4-yl)ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175971441 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 3-[6-[2-(2-tert-butyl-1-piperidin-4-ylpiperidin-4-yl)ethynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)C1CC(C#Cc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)CCN1C1CCNCC1 |
| InChI | InChI=1S/C29H38N4O3/c1-29(2,3)25-17-20(12-15-32(25)22-10-13-30-14-11-22)5-4-19-6-7-23-21(16-19)18-33(28(23)36)24-8-9-26(34)31-27(24)35/h6-7,16,20,22,24-25,30H,8-15,17-18H2,1-3H3,(H,31,34,35) |
| InChIKey | QIRYHSZOUVMSSB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|